C12H8F2O2S2 — CID 64639086
1-(2,4-difluorophenyl)-2-thiophen-2-ylsulfinylethanone (PubChem CID 64639086) has the molecular formula C12H8F2O2S2 and a molecular weight of 286.32 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-thiophen-2-ylsulfinylethanone.
| Compound Name | 1-(2,4-difluorophenyl)-2-thiophen-2-ylsulfinylethanone |
|---|---|
| PubChem CID | 64639086 |
| Molecular Formula | C12H8F2O2S2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-thiophen-2-ylsulfinylethanone |
| SMILES | O=C(CS(=O)c1cccs1)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H8F2O2S2/c13-8-3-4-9(10(14)6-8)11(15)7-18(16)12-2-1-5-17-12/h1-6H,7H2 |
| InChIKey | FZHFMHJHLGIGFU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |