C11H12F2O2S — CID 64639884
1-(2,4-difluorophenyl)-2-propylsulfinylethanone (PubChem CID 64639884) has the molecular formula C11H12F2O2S and a molecular weight of 246.28 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-propylsulfinylethanone.
| Compound Name | 1-(2,4-difluorophenyl)-2-propylsulfinylethanone |
|---|---|
| PubChem CID | 64639884 |
| Molecular Formula | C11H12F2O2S |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-propylsulfinylethanone |
| SMILES | CCCS(=O)CC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H12F2O2S/c1-2-5-16(15)7-11(14)9-4-3-8(12)6-10(9)13/h3-4,6H,2,5,7H2,1H3 |
| InChIKey | NXMBWCLVSPAOQK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |