C34H14N4O2S6 — CID 169314249
[2-[7-(thiophene-2-carbonyl)-[1,3]benzothiazolo[6,5-f][1,3]benzothiazol-2-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazol-7-yl]-thiophen-2-ylmethanone (PubChem CID 169314249) has the molecular formula C34H14N4O2S6 and a molecular weight of 702.91 g/mol. Its IUPAC name is [2-[7-(thiophene-2-carbonyl)-[1,3]benzothiazolo[6,5-f][1,3]benzothiazol-2-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazol-7-yl]-thiophen-2-ylmethanone.
| Compound Name | [2-[7-(thiophene-2-carbonyl)-[1,3]benzothiazolo[6,5-f][1,3]benzothiazol-2-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazol-7-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 169314249 |
| Molecular Formula | C34H14N4O2S6 |
| Molecular Weight | 702.91 g/mol |
| Exact Mass | 701.94 |
| IUPAC Name | [2-[7-(thiophene-2-carbonyl)-[1,3]benzothiazolo[6,5-f][1,3]benzothiazol-2-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazol-7-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)c1nc2cc3cc4sc(-c5nc6cc7cc8sc(C(=O)c9cccs9)nc8cc7cc6s5)nc4cc3cc2s1 |
| InChI | InChI=1S/C34H14N4O2S6/c39-29(23-3-1-5-41-23)31-35-19-7-15-13-27-21(9-17(15)11-25(19)43-31)37-33(45-27)34-38-22-10-18-12-26-20(8-16(18)14-28(22)46-34)36-32(44-26)30(40)24-4-2-6-42-24/h1-14H |
| InChIKey | RIJUOOQFYLLLOJ-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 85.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.91 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |