C11H18N2O4S — CID 141160501
(5-amino-1-carboxypentyl)azanium;thiophene-2-carboxylate (PubChem CID 141160501) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is (5-amino-1-carboxypentyl)azanium;thiophene-2-carboxylate.
| Compound Name | (5-amino-1-carboxypentyl)azanium;thiophene-2-carboxylate |
|---|---|
| PubChem CID | 141160501 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | (5-amino-1-carboxypentyl)azanium;thiophene-2-carboxylate |
| SMILES | NCCCCC([NH3+])C(=O)O.O=C([O-])c1cccs1 |
| InChI | InChI=1S/C6H14N2O2.C5H4O2S/c7-4-2-1-3-5(8)6(9)10;6-5(7)4-2-1-3-8-4/h5H,1-4,7-8H2,(H,9,10);1-3H,(H,6,7) |
| InChIKey | BMKMZHOFVCMKCC-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 131.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|