C10H16N2O2S — CID 139509790
(2S)-2,6-diamino-3-thiophen-2-ylhexanoic acid (PubChem CID 139509790) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is (2S)-2,6-diamino-3-thiophen-2-ylhexanoic acid.
| Compound Name | (2S)-2,6-diamino-3-thiophen-2-ylhexanoic acid |
|---|---|
| PubChem CID | 139509790 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | (2S)-2,6-diamino-3-thiophen-2-ylhexanoic acid |
| SMILES | NCCCC(c1cccs1)[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H16N2O2S/c11-5-1-3-7(9(12)10(13)14)8-4-2-6-15-8/h2,4,6-7,9H,1,3,5,11-12H2,(H,13,14)/t7?,9-/m0/s1 |
| InChIKey | UMYNPHUXDCOEPS-NETXQHHPSA-N |
| XLogP | 0.98 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |