C10H5F5N2OS2 — CID 91926726
[2-amino-4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-5-yl]-thiophen-2-ylmethanone (PubChem CID 91926726) has the molecular formula C10H5F5N2OS2 and a molecular weight of 328.29 g/mol. Its IUPAC name is [2-amino-4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-5-yl]-thiophen-2-ylmethanone.
| Compound Name | [2-amino-4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-5-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 91926726 |
| Molecular Formula | C10H5F5N2OS2 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | [2-amino-4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-5-yl]-thiophen-2-ylmethanone |
| SMILES | Nc1nc(C(F)(F)C(F)(F)F)c(C(=O)c2cccs2)s1 |
| InChI | InChI=1S/C10H5F5N2OS2/c11-9(12,10(13,14)15)7-6(20-8(16)17-7)5(18)4-2-1-3-19-4/h1-3H,(H2,16,17) |
| InChIKey | SRHSQCOOATZTRZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|