C12H4BrClF5NOS — CID 91926418
(4-bromophenyl)-[2-chloro-4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-5-yl]methanone (PubChem CID 91926418) has the molecular formula C12H4BrClF5NOS and a molecular weight of 420.58 g/mol. Its IUPAC name is (4-bromophenyl)-[2-chloro-4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-5-yl]methanone.
| Compound Name | (4-bromophenyl)-[2-chloro-4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 91926418 |
| Molecular Formula | C12H4BrClF5NOS |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 418.88 |
| IUPAC Name | (4-bromophenyl)-[2-chloro-4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-5-yl]methanone |
| SMILES | O=C(c1ccc(Br)cc1)c1sc(Cl)nc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H4BrClF5NOS/c13-6-3-1-5(2-4-6)7(21)8-9(20-10(14)22-8)11(15,16)12(17,18)19/h1-4H |
| InChIKey | LYAMTVDAMPCFKG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|