C15H14N2O2S2 — CID 163347249
1-[2-[5-(furan-2-yl)thiophen-2-yl]ethyl]-3-thiophen-2-ylurea (PubChem CID 163347249) has the molecular formula C15H14N2O2S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-[2-[5-(furan-2-yl)thiophen-2-yl]ethyl]-3-thiophen-2-ylurea.
| Compound Name | 1-[2-[5-(furan-2-yl)thiophen-2-yl]ethyl]-3-thiophen-2-ylurea |
|---|---|
| PubChem CID | 163347249 |
| Molecular Formula | C15H14N2O2S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 1-[2-[5-(furan-2-yl)thiophen-2-yl]ethyl]-3-thiophen-2-ylurea |
| SMILES | O=C(NCCc1ccc(-c2ccco2)s1)Nc1cccs1 |
| InChI | InChI=1S/C15H14N2O2S2/c18-15(17-14-4-2-10-20-14)16-8-7-11-5-6-13(21-11)12-3-1-9-19-12/h1-6,9-10H,7-8H2,(H2,16,17,18) |
| InChIKey | JYLQXCDXPOXIQX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |