C18H16N2O4S — CID 163347257
1-(1,3-benzodioxol-5-yl)-3-[2-[5-(furan-2-yl)thiophen-2-yl]ethyl]urea (PubChem CID 163347257) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[2-[5-(furan-2-yl)thiophen-2-yl]ethyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[2-[5-(furan-2-yl)thiophen-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 163347257 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[2-[5-(furan-2-yl)thiophen-2-yl]ethyl]urea |
| SMILES | O=C(NCCc1ccc(-c2ccco2)s1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H16N2O4S/c21-18(20-12-3-5-14-16(10-12)24-11-23-14)19-8-7-13-4-6-17(25-13)15-2-1-9-22-15/h1-6,9-10H,7-8,11H2,(H2,19,20,21) |
| InChIKey | UVHPHPKFYSUTGC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |