C18H14N2O2S — CID 163347198
4-cyano-N-[2-[5-(furan-2-yl)thiophen-2-yl]ethyl]benzamide (PubChem CID 163347198) has the molecular formula C18H14N2O2S and a molecular weight of 322.39 g/mol. Its IUPAC name is 4-cyano-N-[2-[5-(furan-2-yl)thiophen-2-yl]ethyl]benzamide.
| Compound Name | 4-cyano-N-[2-[5-(furan-2-yl)thiophen-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 163347198 |
| Molecular Formula | C18H14N2O2S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 4-cyano-N-[2-[5-(furan-2-yl)thiophen-2-yl]ethyl]benzamide |
| SMILES | N#Cc1ccc(C(=O)NCCc2ccc(-c3ccco3)s2)cc1 |
| InChI | InChI=1S/C18H14N2O2S/c19-12-13-3-5-14(6-4-13)18(21)20-10-9-15-7-8-17(23-15)16-2-1-11-22-16/h1-8,11H,9-10H2,(H,20,21) |
| InChIKey | GFEDYXMZYXXQBK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |