C11H9NO2S2 — CID 82119497
2-methylsulfanyl-6-thiophen-2-ylpyridine-3-carboxylic acid (PubChem CID 82119497) has the molecular formula C11H9NO2S2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-methylsulfanyl-6-thiophen-2-ylpyridine-3-carboxylic acid.
| Compound Name | 2-methylsulfanyl-6-thiophen-2-ylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 82119497 |
| Molecular Formula | C11H9NO2S2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | 2-methylsulfanyl-6-thiophen-2-ylpyridine-3-carboxylic acid |
| SMILES | CSc1nc(-c2cccs2)ccc1C(=O)O |
| InChI | InChI=1S/C11H9NO2S2/c1-15-10-7(11(13)14)4-5-8(12-10)9-3-2-6-16-9/h2-6H,1H3,(H,13,14) |
| InChIKey | BJYNEUKZORPCMD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |