C18H16N2OS — CID 39428121
N,2-dimethyl-N-phenyl-6-thiophen-2-ylpyridine-3-carboxamide (PubChem CID 39428121) has the molecular formula C18H16N2OS and a molecular weight of 308.41 g/mol. Its IUPAC name is N,2-dimethyl-N-phenyl-6-thiophen-2-ylpyridine-3-carboxamide.
| Compound Name | N,2-dimethyl-N-phenyl-6-thiophen-2-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 39428121 |
| Molecular Formula | C18H16N2OS |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | N,2-dimethyl-N-phenyl-6-thiophen-2-ylpyridine-3-carboxamide |
| SMILES | Cc1nc(-c2cccs2)ccc1C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C18H16N2OS/c1-13-15(10-11-16(19-13)17-9-6-12-22-17)18(21)20(2)14-7-4-3-5-8-14/h3-12H,1-2H3 |
| InChIKey | ULFKWNFQKPXYIM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |