C19H23N3O3 — CID 171471952
tert-butyl N-[6-methyl-5-[methyl(phenyl)carbamoyl]-2-pyridinyl]carbamate (PubChem CID 171471952) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is tert-butyl N-[6-methyl-5-[methyl(phenyl)carbamoyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-methyl-5-[methyl(phenyl)carbamoyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 171471952 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | tert-butyl N-[6-methyl-5-[methyl(phenyl)carbamoyl]-2-pyridinyl]carbamate |
| SMILES | Cc1nc(NC(=O)OC(C)(C)C)ccc1C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C19H23N3O3/c1-13-15(17(23)22(5)14-9-7-6-8-10-14)11-12-16(20-13)21-18(24)25-19(2,3)4/h6-12H,1-5H3,(H,20,21,24) |
| InChIKey | INRIKJMXDZECPJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |