C33H38N6O6S — CID 59855016
10-(5-nitrothiophen-2-yl)-22,25,30,33-tetraoxa-1,19,36,37,38-pentazapentacyclo[17.8.8.13,7.18,12.113,17]octatriaconta-3(38),4,6,8,10,12(37),13,15,17(36)-nonaene (PubChem CID 59855016) has the molecular formula C33H38N6O6S and a molecular weight of 646.77 g/mol. Its IUPAC name is 10-(5-nitrothiophen-2-yl)-22,25,30,33-tetraoxa-1,19,36,37,38-pentazapentacyclo[17.8.8.13,7.18,12.113,17]octatriaconta-3(38),4,6,8,10,12(37),13,15,17(36)-nonaene.
| Compound Name | 10-(5-nitrothiophen-2-yl)-22,25,30,33-tetraoxa-1,19,36,37,38-pentazapentacyclo[17.8.8.13,7.18,12.113,17]octatriaconta-3(38),4,6,8,10,12(37),13,15,17(36)-nonaene |
|---|---|
| PubChem CID | 59855016 |
| Molecular Formula | C33H38N6O6S |
| Molecular Weight | 646.77 g/mol |
| Exact Mass | 646.26 |
| IUPAC Name | 10-(5-nitrothiophen-2-yl)-22,25,30,33-tetraoxa-1,19,36,37,38-pentazapentacyclo[17.8.8.13,7.18,12.113,17]octatriaconta-3(38),4,6,8,10,12(37),13,15,17(36)-nonaene |
| SMILES | O=[N+]([O-])c1ccc(-c2cc3nc(c2)-c2cccc(n2)CN2CCOCCOCCN(CCOCCOCC2)Cc2cccc-3n2)s1 |
| InChI | InChI=1S/C33H38N6O6S/c40-39(41)33-8-7-32(46-33)25-21-30-28-5-1-3-26(34-28)23-37-9-13-42-17-19-44-15-11-38(12-16-45-20-18-43-14-10-37)24-27-4-2-6-29(35-27)31(22-25)36-30/h1-8,21-22H,9-20,23-24H2 |
| InChIKey | IQIJQAXGVSVJRS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 125.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.77 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|