C15H25CdN3O2+2 — CID 139245965
cadmium(2+);3,12-dimethyl-6,9-dioxa-3,12,18-triazabicyclo[12.3.1]octadeca-1(18),14,16-triene (PubChem CID 139245965) has the molecular formula C15H25CdN3O2+2 and a molecular weight of 391.80 g/mol. Its IUPAC name is cadmium(2+);3,12-dimethyl-6,9-dioxa-3,12,18-triazabicyclo[12.3.1]octadeca-1(18),14,16-triene.
| Compound Name | cadmium(2+);3,12-dimethyl-6,9-dioxa-3,12,18-triazabicyclo[12.3.1]octadeca-1(18),14,16-triene |
|---|---|
| PubChem CID | 139245965 |
| Molecular Formula | C15H25CdN3O2+2 |
| Molecular Weight | 391.80 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | cadmium(2+);3,12-dimethyl-6,9-dioxa-3,12,18-triazabicyclo[12.3.1]octadeca-1(18),14,16-triene |
| SMILES | CN1CCOCCOCCN(C)Cc2cccc(n2)C1.[Cd+2] |
| InChI | InChI=1S/C15H25N3O2.Cd/c1-17-6-8-19-10-11-20-9-7-18(2)13-15-5-3-4-14(12-17)16-15;/h3-5H,6-13H2,1-2H3;/q;+2 |
| InChIKey | SEAPPVUJWBKAGH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.80 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |