C17H27NO5 — CID 102505485
(5S,13S)-5,13-dimethyl-3,6,9,12,15-pentaoxa-21-azabicyclo[15.3.1]henicosa-1(21),17,19-triene (PubChem CID 102505485) has the molecular formula C17H27NO5 and a molecular weight of 325.40 g/mol. Its IUPAC name is (5S,13S)-5,13-dimethyl-3,6,9,12,15-pentaoxa-21-azabicyclo[15.3.1]henicosa-1(21),17,19-triene.
| Compound Name | (5S,13S)-5,13-dimethyl-3,6,9,12,15-pentaoxa-21-azabicyclo[15.3.1]henicosa-1(21),17,19-triene |
|---|---|
| PubChem CID | 102505485 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | (5S,13S)-5,13-dimethyl-3,6,9,12,15-pentaoxa-21-azabicyclo[15.3.1]henicosa-1(21),17,19-triene |
| SMILES | C[C@H]1COCc2cccc(n2)COC[C@H](C)OCCOCCO1 |
| InChI | InChI=1S/C17H27NO5/c1-14-10-20-12-16-4-3-5-17(18-16)13-21-11-15(2)23-9-7-19-6-8-22-14/h3-5,14-15H,6-13H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | DAMFSSNXHMOEBY-GJZGRUSLSA-N |
| XLogP | 1.96 |
| TPSA | 59.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |