C17H25NO2 — CID 177463087
(8E)-3,14-dioxa-20-azabicyclo[14.3.1]icosa-1(20),8,16,18-tetraene (PubChem CID 177463087) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is (8E)-3,14-dioxa-20-azabicyclo[14.3.1]icosa-1(20),8,16,18-tetraene.
| Compound Name | (8E)-3,14-dioxa-20-azabicyclo[14.3.1]icosa-1(20),8,16,18-tetraene |
|---|---|
| PubChem CID | 177463087 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (8E)-3,14-dioxa-20-azabicyclo[14.3.1]icosa-1(20),8,16,18-tetraene |
| SMILES | C1=C/CCCCOCc2cccc(n2)COCCCC/1 |
| InChI | InChI=1S/C17H25NO2/c1-2-4-6-8-13-20-15-17-11-9-10-16(18-17)14-19-12-7-5-3-1/h1-2,9-11H,3-8,12-15H2/b2-1+ |
| InChIKey | HYMFUOVFGUVGGK-OWOJBTEDSA-N |
| XLogP | 4.03 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|