C24H36N6O4 — CID 102030996
17,20,25,28-tetraoxa-1,14,31,32-tetrazatetracyclo[12.8.8.13,7.18,12]dotriaconta-3(32),4,6,8,10,12(31)-hexaene-6,9-diamine (PubChem CID 102030996) has the molecular formula C24H36N6O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is 17,20,25,28-tetraoxa-1,14,31,32-tetrazatetracyclo[12.8.8.13,7.18,12]dotriaconta-3(32),4,6,8,10,12(31)-hexaene-6,9-diamine.
| Compound Name | 17,20,25,28-tetraoxa-1,14,31,32-tetrazatetracyclo[12.8.8.13,7.18,12]dotriaconta-3(32),4,6,8,10,12(31)-hexaene-6,9-diamine |
|---|---|
| PubChem CID | 102030996 |
| Molecular Formula | C24H36N6O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 17,20,25,28-tetraoxa-1,14,31,32-tetrazatetracyclo[12.8.8.13,7.18,12]dotriaconta-3(32),4,6,8,10,12(31)-hexaene-6,9-diamine |
| SMILES | Nc1ccc2nc1-c1nc(ccc1N)CN1CCOCCOCCN(CCOCCOCC1)C2 |
| InChI | InChI=1S/C24H36N6O4/c25-21-3-1-19-17-29-5-9-31-13-15-33-11-7-30(8-12-34-16-14-32-10-6-29)18-20-2-4-22(26)24(28-20)23(21)27-19/h1-4H,5-18,25-26H2 |
| InChIKey | SNOQZQHKPGSDPB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 121.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |