C9H15N5O — CID 83003580
6-N-morpholin-4-ylpyridine-2,3,6-triamine (PubChem CID 83003580) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is 6-N-morpholin-4-ylpyridine-2,3,6-triamine.
| Compound Name | 6-N-morpholin-4-ylpyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 83003580 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 6-N-morpholin-4-ylpyridine-2,3,6-triamine |
| SMILES | Nc1ccc(NN2CCOCC2)nc1N |
| InChI | InChI=1S/C9H15N5O/c10-7-1-2-8(12-9(7)11)13-14-3-5-15-6-4-14/h1-2H,3-6,10H2,(H3,11,12,13) |
| InChIKey | PBXLFBPUHDPVTK-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |