C9H13ClN4O — CID 83003958
6-chloro-2-N-morpholin-4-ylpyridine-2,3-diamine (PubChem CID 83003958) has the molecular formula C9H13ClN4O and a molecular weight of 228.68 g/mol. Its IUPAC name is 6-chloro-2-N-morpholin-4-ylpyridine-2,3-diamine.
| Compound Name | 6-chloro-2-N-morpholin-4-ylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 83003958 |
| Molecular Formula | C9H13ClN4O |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 6-chloro-2-N-morpholin-4-ylpyridine-2,3-diamine |
| SMILES | Nc1ccc(Cl)nc1NN1CCOCC1 |
| InChI | InChI=1S/C9H13ClN4O/c10-8-2-1-7(11)9(12-8)13-14-3-5-15-6-4-14/h1-2H,3-6,11H2,(H,12,13) |
| InChIKey | AIYVNORSVLZROW-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|