C9H13ClN4O2 — CID 83025406
N-(5-chloro-2-methoxypyrimidin-4-yl)morpholin-4-amine (PubChem CID 83025406) has the molecular formula C9H13ClN4O2 and a molecular weight of 244.68 g/mol. Its IUPAC name is N-(5-chloro-2-methoxypyrimidin-4-yl)morpholin-4-amine.
| Compound Name | N-(5-chloro-2-methoxypyrimidin-4-yl)morpholin-4-amine |
|---|---|
| PubChem CID | 83025406 |
| Molecular Formula | C9H13ClN4O2 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | N-(5-chloro-2-methoxypyrimidin-4-yl)morpholin-4-amine |
| SMILES | COc1ncc(Cl)c(NN2CCOCC2)n1 |
| InChI | InChI=1S/C9H13ClN4O2/c1-15-9-11-6-7(10)8(12-9)13-14-2-4-16-5-3-14/h6H,2-5H2,1H3,(H,11,12,13) |
| InChIKey | CMPPVAHTYQNOQJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |