C10H16ClN5O — CID 83027231
5-chloro-2-N-ethyl-4-N-morpholin-4-ylpyrimidine-2,4-diamine (PubChem CID 83027231) has the molecular formula C10H16ClN5O and a molecular weight of 257.72 g/mol. Its IUPAC name is 5-chloro-2-N-ethyl-4-N-morpholin-4-ylpyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-ethyl-4-N-morpholin-4-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 83027231 |
| Molecular Formula | C10H16ClN5O |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 5-chloro-2-N-ethyl-4-N-morpholin-4-ylpyrimidine-2,4-diamine |
| SMILES | CCNc1ncc(Cl)c(NN2CCOCC2)n1 |
| InChI | InChI=1S/C10H16ClN5O/c1-2-12-10-13-7-8(11)9(14-10)15-16-3-5-17-6-4-16/h7H,2-6H2,1H3,(H2,12,13,14,15) |
| InChIKey | WUZCCAQXBMYXTL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |