C9H10Cl3N3O — CID 102751710
N-(3,5,6-trichloro-2-pyridinyl)morpholin-4-amine (PubChem CID 102751710) has the molecular formula C9H10Cl3N3O and a molecular weight of 282.56 g/mol. Its IUPAC name is N-(3,5,6-trichloro-2-pyridinyl)morpholin-4-amine.
| Compound Name | N-(3,5,6-trichloro-2-pyridinyl)morpholin-4-amine |
|---|---|
| PubChem CID | 102751710 |
| Molecular Formula | C9H10Cl3N3O |
| Molecular Weight | 282.56 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | N-(3,5,6-trichloro-2-pyridinyl)morpholin-4-amine |
| SMILES | Clc1cc(Cl)c(NN2CCOCC2)nc1Cl |
| InChI | InChI=1S/C9H10Cl3N3O/c10-6-5-7(11)9(13-8(6)12)14-15-1-3-16-4-2-15/h5H,1-4H2,(H,13,14) |
| InChIKey | UWNUZFHRNIJKHN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.56 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|