C6H11N5OS — CID 83024360
5-N-morpholin-4-yl-1,2,4-thiadiazole-3,5-diamine (PubChem CID 83024360) has the molecular formula C6H11N5OS and a molecular weight of 201.25 g/mol. Its IUPAC name is 5-N-morpholin-4-yl-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 5-N-morpholin-4-yl-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 83024360 |
| Molecular Formula | C6H11N5OS |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 5-N-morpholin-4-yl-1,2,4-thiadiazole-3,5-diamine |
| SMILES | Nc1nsc(NN2CCOCC2)n1 |
| InChI | InChI=1S/C6H11N5OS/c7-5-8-6(13-10-5)9-11-1-3-12-4-2-11/h1-4H2,(H3,7,8,9,10) |
| InChIKey | HPKKGZXZWGEYTI-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |