C19H19N3OS — CID 10065675
N-(4,5-diphenyl-1,3-thiazol-2-yl)morpholin-4-amine (PubChem CID 10065675) has the molecular formula C19H19N3OS and a molecular weight of 337.45 g/mol. Its IUPAC name is N-(4,5-diphenyl-1,3-thiazol-2-yl)morpholin-4-amine.
| Compound Name | N-(4,5-diphenyl-1,3-thiazol-2-yl)morpholin-4-amine |
|---|---|
| PubChem CID | 10065675 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N-(4,5-diphenyl-1,3-thiazol-2-yl)morpholin-4-amine |
| SMILES | c1ccc(-c2nc(NN3CCOCC3)sc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H19N3OS/c1-3-7-15(8-4-1)17-18(16-9-5-2-6-10-16)24-19(20-17)21-22-11-13-23-14-12-22/h1-10H,11-14H2,(H,20,21) |
| InChIKey | REOLKFSCUQLGQN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |