C17H16N2OS2 — CID 15724124
4-(5-phenyl-4-thiophen-2-yl-1,3-thiazol-2-yl)morpholine (PubChem CID 15724124) has the molecular formula C17H16N2OS2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 4-(5-phenyl-4-thiophen-2-yl-1,3-thiazol-2-yl)morpholine.
| Compound Name | 4-(5-phenyl-4-thiophen-2-yl-1,3-thiazol-2-yl)morpholine |
|---|---|
| PubChem CID | 15724124 |
| Molecular Formula | C17H16N2OS2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 4-(5-phenyl-4-thiophen-2-yl-1,3-thiazol-2-yl)morpholine |
| SMILES | c1ccc(-c2sc(N3CCOCC3)nc2-c2cccs2)cc1 |
| InChI | InChI=1S/C17H16N2OS2/c1-2-5-13(6-3-1)16-15(14-7-4-12-21-14)18-17(22-16)19-8-10-20-11-9-19/h1-7,12H,8-11H2 |
| InChIKey | UAKPPGSSPKMQOT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |