C22H20N6OS — CID 9027935
(Z)-1-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine (PubChem CID 9027935) has the molecular formula C22H20N6OS and a molecular weight of 416.51 g/mol. Its IUPAC name is (Z)-1-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine.
| Compound Name | (Z)-1-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 9027935 |
| Molecular Formula | C22H20N6OS |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (Z)-1-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine |
| SMILES | C(=N\n1cnnc1-c1ccccc1)\c1sc(N2CCOCC2)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H20N6OS/c1-3-7-17(8-4-1)20-19(30-22(25-20)27-11-13-29-14-12-27)15-24-28-16-23-26-21(28)18-9-5-2-6-10-18/h1-10,15-16H,11-14H2/b24-15- |
| InChIKey | LWBAIXSBLDAFRK-IWIPYMOSSA-N |
| XLogP | 3.79 |
| TPSA | 68.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|