C21H28N4OS — CID 9012646
(Z)-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-1-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methanimine (PubChem CID 9012646) has the molecular formula C21H28N4OS and a molecular weight of 384.55 g/mol. Its IUPAC name is (Z)-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-1-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methanimine.
| Compound Name | (Z)-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-1-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methanimine |
|---|---|
| PubChem CID | 9012646 |
| Molecular Formula | C21H28N4OS |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (Z)-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-1-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methanimine |
| SMILES | C[C@H]1CCC[C@H](C)N1/N=C\c1sc(N2CCOCC2)nc1-c1ccccc1 |
| InChI | InChI=1S/C21H28N4OS/c1-16-7-6-8-17(2)25(16)22-15-19-20(18-9-4-3-5-10-18)23-21(27-19)24-11-13-26-14-12-24/h3-5,9-10,15-17H,6-8,11-14H2,1-2H3/b22-15-/t16-,17-/m0/s1 |
| InChIKey | KIYBTXQBDAWXDC-PBZAEIMMSA-N |
| XLogP | 4.24 |
| TPSA | 40.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|