C19H24N2O4S — CID 167862109
5-hydroxypentyl 2-morpholin-4-yl-4-phenyl-1,3-thiazole-5-carboxylate (PubChem CID 167862109) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is 5-hydroxypentyl 2-morpholin-4-yl-4-phenyl-1,3-thiazole-5-carboxylate.
| Compound Name | 5-hydroxypentyl 2-morpholin-4-yl-4-phenyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 167862109 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 5-hydroxypentyl 2-morpholin-4-yl-4-phenyl-1,3-thiazole-5-carboxylate |
| SMILES | O=C(OCCCCCO)c1sc(N2CCOCC2)nc1-c1ccccc1 |
| InChI | InChI=1S/C19H24N2O4S/c22-11-5-2-6-12-25-18(23)17-16(15-7-3-1-4-8-15)20-19(26-17)21-9-13-24-14-10-21/h1,3-4,7-8,22H,2,5-6,9-14H2 |
| InChIKey | VYYUDMRDEMUBHR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|