C11H12ClN3OS — CID 83018453
N-(6-chloro-1,3-benzothiazol-2-yl)morpholin-4-amine (PubChem CID 83018453) has the molecular formula C11H12ClN3OS and a molecular weight of 269.76 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)morpholin-4-amine.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)morpholin-4-amine |
|---|---|
| PubChem CID | 83018453 |
| Molecular Formula | C11H12ClN3OS |
| Molecular Weight | 269.76 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)morpholin-4-amine |
| SMILES | Clc1ccc2nc(NN3CCOCC3)sc2c1 |
| InChI | InChI=1S/C11H12ClN3OS/c12-8-1-2-9-10(7-8)17-11(13-9)14-15-3-5-16-6-4-15/h1-2,7H,3-6H2,(H,13,14) |
| InChIKey | ZWUWKGBJDBSQNW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.76 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |