C21H21N3O2S — CID 16644485
N-[5-(morpholin-4-ylmethyl)-4-phenyl-1,3-thiazol-2-yl]benzamide (PubChem CID 16644485) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is N-[5-(morpholin-4-ylmethyl)-4-phenyl-1,3-thiazol-2-yl]benzamide.
| Compound Name | N-[5-(morpholin-4-ylmethyl)-4-phenyl-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 16644485 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | N-[5-(morpholin-4-ylmethyl)-4-phenyl-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)c(CN2CCOCC2)s1)c1ccccc1 |
| InChI | InChI=1S/C21H21N3O2S/c25-20(17-9-5-2-6-10-17)23-21-22-19(16-7-3-1-4-8-16)18(27-21)15-24-11-13-26-14-12-24/h1-10H,11-15H2,(H,22,23,25) |
| InChIKey | YHZQJWILRJMTFX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |