C21H23N3O4S2 — CID 108780400
4-methoxy-N-[5-(morpholin-4-ylmethyl)-4-phenyl-1,3-thiazol-2-yl]benzenesulfonamide (PubChem CID 108780400) has the molecular formula C21H23N3O4S2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 4-methoxy-N-[5-(morpholin-4-ylmethyl)-4-phenyl-1,3-thiazol-2-yl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[5-(morpholin-4-ylmethyl)-4-phenyl-1,3-thiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 108780400 |
| Molecular Formula | C21H23N3O4S2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 4-methoxy-N-[5-(morpholin-4-ylmethyl)-4-phenyl-1,3-thiazol-2-yl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2nc(-c3ccccc3)c(CN3CCOCC3)s2)cc1 |
| InChI | InChI=1S/C21H23N3O4S2/c1-27-17-7-9-18(10-8-17)30(25,26)23-21-22-20(16-5-3-2-4-6-16)19(29-21)15-24-11-13-28-14-12-24/h2-10H,11-15H2,1H3,(H,22,23) |
| InChIKey | GETIIRKPFIEJGF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|