About [4-[(3-amino-1,2,4-thiadiazol-5-yl)amino]oxan-4-yl]methanol
[4-[(3-amino-1,2,4-thiadiazol-5-yl)amino]oxan-4-yl]methanol (PubChem CID 106301087) has the molecular formula C8H14N4O2S
and a molecular weight of 230.29 g/mol. Its IUPAC name is [4-[(3-amino-1,2,4-thiadiazol-5-yl)amino]oxan-4-yl]methanol.
Molecular Properties
| Compound Name | [4-[(3-amino-1,2,4-thiadiazol-5-yl)amino]oxan-4-yl]methanol |
| PubChem CID | 106301087 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | [4-[(3-amino-1,2,4-thiadiazol-5-yl)amino]oxan-4-yl]methanol |
| SMILES | Nc1nsc(NC2(CO)CCOCC2)n1 |
| InChI | InChI=1S/C8H14N4O2S/c9-6-10-7(15-12-6)11-8(5-13)1-3-14-4-2-8/h13H,1-5H2,(H3,9,10,11,12) |
| InChIKey | BJVJUYZSUZSRED-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [4-[(3-amino-1,2,4-thiadiazol-5-yl)amino]oxan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(3-amino-1,2,4-thiadiazol-5-yl)amino]oxan-4-yl]methanol?
The IUPAC name of [4-[(3-amino-1,2,4-thiadiazol-5-yl)amino]oxan-4-yl]methanol (CID 106301087) is [4-[(3-amino-1,2,4-thiadiazol-5-yl)amino]oxan-4-yl]methanol.
What is the SMILES notation for [4-[(3-amino-1,2,4-thiadiazol-5-yl)amino]oxan-4-yl]methanol?
The canonical SMILES for [4-[(3-amino-1,2,4-thiadiazol-5-yl)amino]oxan-4-yl]methanol is Nc1nsc(NC2(CO)CCOCC2)n1.
What is the InChIKey of [4-[(3-amino-1,2,4-thiadiazol-5-yl)amino]oxan-4-yl]methanol?
The InChIKey is BJVJUYZSUZSRED-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O2S/c9-6-10-7(15-12-6)11-8(5-13)1-3-14-4-2-8/h13H,1-5H2,(H3,9,10,11,12).
What are the key properties of [4-[(3-amino-1,2,4-thiadiazol-5-yl)amino]oxan-4-yl]methanol?
[4-[(3-amino-1,2,4-thiadiazol-5-yl)amino]oxan-4-yl]methanol has a molecular weight of 230.29 g/mol, XLogP of 0.07, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(3-amino-1,2,4-thiadiazol-5-yl)amino]oxan-4-yl]methanol is sourced from PubChem (CID 106301087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).