C9H14ClN3OS — CID 106300262
N-[4-(chloromethyl)oxan-4-yl]-3-methyl-1,2,4-thiadiazol-5-amine (PubChem CID 106300262) has the molecular formula C9H14ClN3OS and a molecular weight of 247.75 g/mol. Its IUPAC name is N-[4-(chloromethyl)oxan-4-yl]-3-methyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-[4-(chloromethyl)oxan-4-yl]-3-methyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 106300262 |
| Molecular Formula | C9H14ClN3OS |
| Molecular Weight | 247.75 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | N-[4-(chloromethyl)oxan-4-yl]-3-methyl-1,2,4-thiadiazol-5-amine |
| SMILES | Cc1nsc(NC2(CCl)CCOCC2)n1 |
| InChI | InChI=1S/C9H14ClN3OS/c1-7-11-8(15-13-7)12-9(6-10)2-4-14-5-3-9/h2-6H2,1H3,(H,11,12,13) |
| InChIKey | KZXHYXSWCQUBOF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.75 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|