C13H16N2O2S — CID 106299620
[4-(2,1-benzothiazol-3-ylamino)oxan-4-yl]methanol (PubChem CID 106299620) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is [4-(2,1-benzothiazol-3-ylamino)oxan-4-yl]methanol.
| Compound Name | [4-(2,1-benzothiazol-3-ylamino)oxan-4-yl]methanol |
|---|---|
| PubChem CID | 106299620 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | [4-(2,1-benzothiazol-3-ylamino)oxan-4-yl]methanol |
| SMILES | OCC1(Nc2snc3ccccc23)CCOCC1 |
| InChI | InChI=1S/C13H16N2O2S/c16-9-13(5-7-17-8-6-13)14-12-10-3-1-2-4-11(10)15-18-12/h1-4,14,16H,5-9H2 |
| InChIKey | WKFYJDYDFFIUKO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |