C12H14N2O2S — CID 103847671
3-[(2,1-benzothiazol-3-ylamino)methyl]oxolan-3-ol (PubChem CID 103847671) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 3-[(2,1-benzothiazol-3-ylamino)methyl]oxolan-3-ol.
| Compound Name | 3-[(2,1-benzothiazol-3-ylamino)methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 103847671 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 3-[(2,1-benzothiazol-3-ylamino)methyl]oxolan-3-ol |
| SMILES | OC1(CNc2snc3ccccc23)CCOC1 |
| InChI | InChI=1S/C12H14N2O2S/c15-12(5-6-16-8-12)7-13-11-9-3-1-2-4-10(9)14-17-11/h1-4,13,15H,5-8H2 |
| InChIKey | KEDPZLNPPZQOCB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |