C11H15F3N4O2 — CID 106301120
[4-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]oxan-4-yl]methanol (PubChem CID 106301120) has the molecular formula C11H15F3N4O2 and a molecular weight of 292.26 g/mol. Its IUPAC name is [4-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]oxan-4-yl]methanol.
| Compound Name | [4-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]oxan-4-yl]methanol |
|---|---|
| PubChem CID | 106301120 |
| Molecular Formula | C11H15F3N4O2 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | [4-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]oxan-4-yl]methanol |
| SMILES | Nc1cc(NC2(CO)CCOCC2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H15F3N4O2/c12-11(13,14)9-16-7(15)5-8(17-9)18-10(6-19)1-3-20-4-2-10/h5,19H,1-4,6H2,(H3,15,16,17,18) |
| InChIKey | UTGKPHRECOGJRD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |