C15H25N3O3 — CID 106296884
[4-[[5-amino-6-[(2-methylpropan-2-yl)oxy]-2-pyridinyl]amino]oxan-4-yl]methanol (PubChem CID 106296884) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is [4-[[5-amino-6-[(2-methylpropan-2-yl)oxy]-2-pyridinyl]amino]oxan-4-yl]methanol.
| Compound Name | [4-[[5-amino-6-[(2-methylpropan-2-yl)oxy]-2-pyridinyl]amino]oxan-4-yl]methanol |
|---|---|
| PubChem CID | 106296884 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | [4-[[5-amino-6-[(2-methylpropan-2-yl)oxy]-2-pyridinyl]amino]oxan-4-yl]methanol |
| SMILES | CC(C)(C)Oc1nc(NC2(CO)CCOCC2)ccc1N |
| InChI | InChI=1S/C15H25N3O3/c1-14(2,3)21-13-11(16)4-5-12(17-13)18-15(10-19)6-8-20-9-7-15/h4-5,19H,6-10,16H2,1-3H3,(H,17,18) |
| InChIKey | MFVHLTJMLUVFGU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |