C13H19F3N4O — CID 106772295
1-[[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]methyl]cycloheptan-1-ol (PubChem CID 106772295) has the molecular formula C13H19F3N4O and a molecular weight of 304.32 g/mol. Its IUPAC name is 1-[[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]methyl]cycloheptan-1-ol.
| Compound Name | 1-[[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]methyl]cycloheptan-1-ol |
|---|---|
| PubChem CID | 106772295 |
| Molecular Formula | C13H19F3N4O |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 1-[[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]methyl]cycloheptan-1-ol |
| SMILES | Nc1cc(NCC2(O)CCCCCC2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H19F3N4O/c14-13(15,16)11-19-9(17)7-10(20-11)18-8-12(21)5-3-1-2-4-6-12/h7,21H,1-6,8H2,(H3,17,18,19,20) |
| InChIKey | GEORPKGDHHHBHV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |