C10H11ClF3N3O2 — CID 106102714
3-[[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]methyl]oxolan-3-ol (PubChem CID 106102714) has the molecular formula C10H11ClF3N3O2 and a molecular weight of 297.66 g/mol. Its IUPAC name is 3-[[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]methyl]oxolan-3-ol.
| Compound Name | 3-[[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 106102714 |
| Molecular Formula | C10H11ClF3N3O2 |
| Molecular Weight | 297.66 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 3-[[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]methyl]oxolan-3-ol |
| SMILES | OC1(CNc2cc(Cl)nc(C(F)(F)F)n2)CCOC1 |
| InChI | InChI=1S/C10H11ClF3N3O2/c11-6-3-7(17-8(16-6)10(12,13)14)15-4-9(18)1-2-19-5-9/h3,18H,1-2,4-5H2,(H,15,16,17) |
| InChIKey | HFCWXKPWICZUMF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.66 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |