C9H11Cl2N3O2 — CID 106102670
3-[[(2,5-dichloropyrimidin-4-yl)amino]methyl]oxolan-3-ol (PubChem CID 106102670) has the molecular formula C9H11Cl2N3O2 and a molecular weight of 264.11 g/mol. Its IUPAC name is 3-[[(2,5-dichloropyrimidin-4-yl)amino]methyl]oxolan-3-ol.
| Compound Name | 3-[[(2,5-dichloropyrimidin-4-yl)amino]methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 106102670 |
| Molecular Formula | C9H11Cl2N3O2 |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 3-[[(2,5-dichloropyrimidin-4-yl)amino]methyl]oxolan-3-ol |
| SMILES | OC1(CNc2nc(Cl)ncc2Cl)CCOC1 |
| InChI | InChI=1S/C9H11Cl2N3O2/c10-6-3-12-8(11)14-7(6)13-4-9(15)1-2-16-5-9/h3,15H,1-2,4-5H2,(H,12,13,14) |
| InChIKey | RQCQQZYDDSOQNB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |