C11H17FN4O2 — CID 114143772
3-[[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]methyl]oxolan-3-ol (PubChem CID 114143772) has the molecular formula C11H17FN4O2 and a molecular weight of 256.28 g/mol. Its IUPAC name is 3-[[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]methyl]oxolan-3-ol.
| Compound Name | 3-[[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 114143772 |
| Molecular Formula | C11H17FN4O2 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 3-[[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]methyl]oxolan-3-ol |
| SMILES | CCNc1ncc(F)c(NCC2(O)CCOC2)n1 |
| InChI | InChI=1S/C11H17FN4O2/c1-2-13-10-14-5-8(12)9(16-10)15-6-11(17)3-4-18-7-11/h5,17H,2-4,6-7H2,1H3,(H2,13,14,15,16) |
| InChIKey | AKJGEUDXFKMEJB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |