C10H15FN4O2 — CID 81131918
4-[[(2-amino-5-fluoropyrimidin-4-yl)amino]methyl]oxan-4-ol (PubChem CID 81131918) has the molecular formula C10H15FN4O2 and a molecular weight of 242.25 g/mol. Its IUPAC name is 4-[[(2-amino-5-fluoropyrimidin-4-yl)amino]methyl]oxan-4-ol.
| Compound Name | 4-[[(2-amino-5-fluoropyrimidin-4-yl)amino]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 81131918 |
| Molecular Formula | C10H15FN4O2 |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 4-[[(2-amino-5-fluoropyrimidin-4-yl)amino]methyl]oxan-4-ol |
| SMILES | Nc1ncc(F)c(NCC2(O)CCOCC2)n1 |
| InChI | InChI=1S/C10H15FN4O2/c11-7-5-13-9(12)15-8(7)14-6-10(16)1-3-17-4-2-10/h5,16H,1-4,6H2,(H3,12,13,14,15) |
| InChIKey | OXEMGSKUBYBLFO-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |