C9H15N3O2S — CID 102768812
4-[[(5-amino-1,3-thiazol-2-yl)amino]methyl]oxan-4-ol (PubChem CID 102768812) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is 4-[[(5-amino-1,3-thiazol-2-yl)amino]methyl]oxan-4-ol.
| Compound Name | 4-[[(5-amino-1,3-thiazol-2-yl)amino]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 102768812 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 4-[[(5-amino-1,3-thiazol-2-yl)amino]methyl]oxan-4-ol |
| SMILES | Nc1cnc(NCC2(O)CCOCC2)s1 |
| InChI | InChI=1S/C9H15N3O2S/c10-7-5-11-8(15-7)12-6-9(13)1-3-14-4-2-9/h5,13H,1-4,6,10H2,(H,11,12) |
| InChIKey | MLUMDRPEOJLAFK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |