C10H14FN3O2 — CID 172899263
4-[[(5-fluoropyrimidin-4-yl)amino]methyl]oxan-4-ol (PubChem CID 172899263) has the molecular formula C10H14FN3O2 and a molecular weight of 227.24 g/mol. Its IUPAC name is 4-[[(5-fluoropyrimidin-4-yl)amino]methyl]oxan-4-ol.
| Compound Name | 4-[[(5-fluoropyrimidin-4-yl)amino]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 172899263 |
| Molecular Formula | C10H14FN3O2 |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-[[(5-fluoropyrimidin-4-yl)amino]methyl]oxan-4-ol |
| SMILES | OC1(CNc2ncncc2F)CCOCC1 |
| InChI | InChI=1S/C10H14FN3O2/c11-8-5-12-7-14-9(8)13-6-10(15)1-3-16-4-2-10/h5,7,15H,1-4,6H2,(H,12,13,14) |
| InChIKey | SXBUMVPDIXPJFA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |