C12H17N3O4 — CID 114214786
methyl 4-[(4-hydroxyoxan-4-yl)methylamino]pyrimidine-5-carboxylate (PubChem CID 114214786) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is methyl 4-[(4-hydroxyoxan-4-yl)methylamino]pyrimidine-5-carboxylate.
| Compound Name | methyl 4-[(4-hydroxyoxan-4-yl)methylamino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 114214786 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | methyl 4-[(4-hydroxyoxan-4-yl)methylamino]pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cncnc1NCC1(O)CCOCC1 |
| InChI | InChI=1S/C12H17N3O4/c1-18-11(16)9-6-13-8-15-10(9)14-7-12(17)2-4-19-5-3-12/h6,8,17H,2-5,7H2,1H3,(H,13,14,15) |
| InChIKey | ZHXONEREWVMQGS-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |