C11H13ClF3N3O2 — CID 114562791
4-[[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]methyl]oxan-4-ol (PubChem CID 114562791) has the molecular formula C11H13ClF3N3O2 and a molecular weight of 311.69 g/mol. Its IUPAC name is 4-[[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]methyl]oxan-4-ol.
| Compound Name | 4-[[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 114562791 |
| Molecular Formula | C11H13ClF3N3O2 |
| Molecular Weight | 311.69 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 4-[[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]methyl]oxan-4-ol |
| SMILES | OC1(CNc2cc(C(F)(F)F)nc(Cl)n2)CCOCC1 |
| InChI | InChI=1S/C11H13ClF3N3O2/c12-9-17-7(11(13,14)15)5-8(18-9)16-6-10(19)1-3-20-4-2-10/h5,19H,1-4,6H2,(H,16,17,18) |
| InChIKey | YFUAIKWPEXWTGW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.69 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |