C12H15F3N2O2 — CID 79839410
4-[[[4-(trifluoromethyl)-2-pyridinyl]amino]methyl]oxan-4-ol (PubChem CID 79839410) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is 4-[[[4-(trifluoromethyl)-2-pyridinyl]amino]methyl]oxan-4-ol.
| Compound Name | 4-[[[4-(trifluoromethyl)-2-pyridinyl]amino]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 79839410 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 4-[[[4-(trifluoromethyl)-2-pyridinyl]amino]methyl]oxan-4-ol |
| SMILES | OC1(CNc2cc(C(F)(F)F)ccn2)CCOCC1 |
| InChI | InChI=1S/C12H15F3N2O2/c13-12(14,15)9-1-4-16-10(7-9)17-8-11(18)2-5-19-6-3-11/h1,4,7,18H,2-3,5-6,8H2,(H,16,17) |
| InChIKey | DHFHLZNKVZSGFH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |