C7H13N5S — CID 83024267
5-N-piperidin-1-yl-1,2,4-thiadiazole-3,5-diamine (PubChem CID 83024267) has the molecular formula C7H13N5S and a molecular weight of 199.28 g/mol. Its IUPAC name is 5-N-piperidin-1-yl-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 5-N-piperidin-1-yl-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 83024267 |
| Molecular Formula | C7H13N5S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 5-N-piperidin-1-yl-1,2,4-thiadiazole-3,5-diamine |
| SMILES | Nc1nsc(NN2CCCCC2)n1 |
| InChI | InChI=1S/C7H13N5S/c8-6-9-7(13-11-6)10-12-4-2-1-3-5-12/h1-5H2,(H3,8,9,10,11) |
| InChIKey | DEZSGKXPLYSBSF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |