C10H17N5S — CID 66279217
5-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-1,2,4-thiadiazole-3,5-diamine (PubChem CID 66279217) has the molecular formula C10H17N5S and a molecular weight of 239.35 g/mol. Its IUPAC name is 5-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 5-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 66279217 |
| Molecular Formula | C10H17N5S |
| Molecular Weight | 239.35 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 5-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-1,2,4-thiadiazole-3,5-diamine |
| SMILES | Nc1nsc(NC2CCN3CCCCC23)n1 |
| InChI | InChI=1S/C10H17N5S/c11-9-13-10(16-14-9)12-7-4-6-15-5-2-1-3-8(7)15/h7-8H,1-6H2,(H3,11,12,13,14) |
| InChIKey | UCRWVXQIZFZOAJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |